CAS 1181458-67-2 is the registry number for 6-Phenoxypyridin-3-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
6-phenoxypyridin-3-amine;dihydrochloride (CAS 1181458-67-2) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 6-phenoxypyridin-3-amine;dihydrochloride. InChIKey: WZXICMOPVQECRE-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 6-phenoxypyridin-3-amine;dihydrochloride |
| InChIKey | WZXICMOPVQECRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)