CAS 81525-12-4 is the registry number for (2,4-Dihydroxy-6-methoxyphenyl)(phenyl)methanone, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 1g.
(2,4-dihydroxy-6-methoxyphenyl)-phenylmethanone (CAS 81525-12-4) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (2,4-dihydroxy-6-methoxyphenyl)-phenylmethanone. InChIKey: CIKBLPYUSUJOHB-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (2,4-dihydroxy-6-methoxyphenyl)-phenylmethanone |
| InChIKey | CIKBLPYUSUJOHB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)