Products 81945-21-3
CAS 81945-21-3 appears in our catalog under these names: 7-Bromo-4-hydroxy-2,3-dihydro-1H-inden-1-one, 96%, 7-Bromo-4-hydroxy-2，3-dihydro-1H-inden-1-one, 96%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-4-hydroxy-2,3-dihydroinden-1-one (CAS 81945-21-3) is a chemical compound with the molecular formula C9H7BrO2 and a molecular weight of 227.05 g/mol. IUPAC name: 7-bromo-4-hydroxy-2,3-dihydroinden-1-one. InChIKey: RUUDIHNJAIWYIR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO2 |
|---|---|
| Molecular weight | 227.05 g/mol |
| IUPAC name | 7-bromo-4-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | RUUDIHNJAIWYIR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)O)Br |
Computed by PubChem (NCBI)