CAS 81964-65-0 appears in our catalog under these names: 1-Acetyl-5-bromo-1h-indole-2,3-dione, 95%, 1-Acetyl-5-bromoindoline-2,3-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-acetyl-5-bromoindole-2,3-dione (CAS 81964-65-0) is a chemical compound with the molecular formula C10H6BrNO3 and a molecular weight of 268.06 g/mol. IUPAC name: 1-acetyl-5-bromoindole-2,3-dione. InChIKey: RWHNHBSIKDWLFH-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO3 |
|---|---|
| Molecular weight | 268.06 g/mol |
| IUPAC name | 1-acetyl-5-bromoindole-2,3-dione |
| InChIKey | RWHNHBSIKDWLFH-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=C(C=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)