CAS 82117-25-7 appears in our catalog under these names: 3-Chloroisoquinolin-7-ol, 95%, 3-Chloroisoquinolin-7-ol, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 500mg, 100mg, 250mg.
3-chloroisoquinolin-7-ol (CAS 82117-25-7) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 3-chloroisoquinolin-7-ol. InChIKey: VSVGOEPXVJBHEJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 3-chloroisoquinolin-7-ol |
| InChIKey | VSVGOEPXVJBHEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CN=C(C=C21)Cl)O |
Computed by PubChem (NCBI)