Products 82228-58-8
CAS 82228-58-8 is the registry number for 3-benzyl-5-nitro-imidazole-4-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
3-benzyl-5-nitroimidazole-4-carboxylic acid (CAS 82228-58-8) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 3-benzyl-5-nitroimidazole-4-carboxylic acid. InChIKey: PYRJLVPDLIDBNE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 3-benzyl-5-nitroimidazole-4-carboxylic acid |
| InChIKey | PYRJLVPDLIDBNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC(=C2C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)