CAS 82477-61-0 appears in our catalog under these names: 2-Chloro-4,6-dimethoxybenzaldehyde, 95%, 2–Chloro–4,6–dimethoxybenzaldehyde, 2-Chloro-4,6-dimethoxybenzaldehyde, 2-Chloro-4,6-dimethoxybenzaldehyde 98%, 2-Chloro-4,6-dimethoxybenzaldehyde, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 2,5g, 100mg, 5g.
2-chloro-4,6-dimethoxybenzaldehyde (CAS 82477-61-0) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2-chloro-4,6-dimethoxybenzaldehyde. InChIKey: WNIGZICIZZIUER-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2-chloro-4,6-dimethoxybenzaldehyde |
| InChIKey | WNIGZICIZZIUER-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)C=O)OC |
Computed by PubChem (NCBI)