CAS 82520-37-4 appears in our catalog under these names: 3-Methoxy-4'-methylbenzophenone, 95%, (3-Methoxyphenyl)(p-tolyl)methanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(3-methoxyphenyl)-(4-methylphenyl)methanone (CAS 82520-37-4) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: (3-methoxyphenyl)-(4-methylphenyl)methanone. InChIKey: KZQIJMIURWFUIS-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (3-methoxyphenyl)-(4-methylphenyl)methanone |
| InChIKey | KZQIJMIURWFUIS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)OC |
Computed by PubChem (NCBI)