CAS 82525-27-7 appears in our catalog under these names: Ethyl 4-(1-methyl-1H-pyrazol-4-yl)benzoate, 97%, Ethyl 4–(1–methyl–1H–pyrazol–4–yl)benzoate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 100mg, 250mg.
Ethyl 4-(1-methylpyrazol-4-yl)benzoate (CAS 82525-27-7) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: ethyl 4-(1-methylpyrazol-4-yl)benzoate. InChIKey: YZBDOBJDOBLBGT-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | ethyl 4-(1-methylpyrazol-4-yl)benzoate |
| InChIKey | YZBDOBJDOBLBGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CN(N=C2)C |
Computed by PubChem (NCBI)