CAS 826-91-5 appears in our catalog under these names: D-Glucaro-1,4:6,3-Dilactone, 1,4:6,3-Glucarodilactone. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 2g, 5g.
(3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione (CAS 826-91-5) is a chemical compound with the molecular formula C6H6O6 and a molecular weight of 174.11 g/mol. IUPAC name: (3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione. InChIKey: QRFNDAVXJCGLFB-GJPGBQJBSA-N.
| Molecular formula | C6H6O6 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | (3R,3aR,6S,6aR)-3,6-dihydroxy-3,3a,6,6a-tetrahydrofuro[3,2-b]furan-2,5-dione |
| InChIKey | QRFNDAVXJCGLFB-GJPGBQJBSA-N |
| SMILES | [C@@H]12[C@@H]([C@@H](C(=O)O1)O)OC(=O)[C@@H]2O |
Computed by PubChem (NCBI)