CAS 82679-58-1 appears in our catalog under these names: Benzyl d-threoninate, 98%, H-D-Thr-OBzl, 95%, H-D-Thr-OBzl, 98%, (2R,3S)-Benzyl 2-amino-3-hydroxybutanoate, 95%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Benzyl (2R,3S)-2-amino-3-hydroxybutanoate (CAS 82679-58-1) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: benzyl (2R,3S)-2-amino-3-hydroxybutanoate. InChIKey: IHRYAQVOEVWURS-WCBMZHEXSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | benzyl (2R,3S)-2-amino-3-hydroxybutanoate |
| InChIKey | IHRYAQVOEVWURS-WCBMZHEXSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OCC1=CC=CC=C1)N)O |
Computed by PubChem (NCBI)