Products 82744-16-9
CAS 82744-16-9 is the registry number for O-Acetylbenzeneamidinocarboxylic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-acetylphenyl)imino-2-aminoacetic acid (CAS 82744-16-9) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 2-(2-acetylphenyl)imino-2-aminoacetic acid. InChIKey: HFLBXTVTCFCWID-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 2-(2-acetylphenyl)imino-2-aminoacetic acid |
| InChIKey | HFLBXTVTCFCWID-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1N=C(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
o-acetylbenzeneamidinocarboxylic acid, orb2943064