CAS 82864-25-3 appears in our catalog under these names: Perindopril Impurity 37, Ethyl L–octahydroindole–2–carboxylate hydrochloride, (2S,3aS,7aS)-Ethyl octahydro-1H-indole-2-carboxylate hydrochloride. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 1g, 250mg, 100mg.
Ethyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate;hydrochloride (CAS 82864-25-3) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: ethyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate;hydrochloride. InChIKey: TWGKMVURZNPDDC-PUBMXKGKSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | ethyl (2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate;hydrochloride |
| InChIKey | TWGKMVURZNPDDC-PUBMXKGKSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1.Cl |
Computed by PubChem (NCBI)