Products 829-06-1
CAS 829-06-1 is the registry number for Ethyl 5-cyano-4-methyl-1H-pyrazole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-cyano-4-methyl-1H-pyrazole-5-carboxylate (CAS 829-06-1) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: ethyl 3-cyano-4-methyl-1H-pyrazole-5-carboxylate. InChIKey: IUCWUXRZUIMIRL-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | ethyl 3-cyano-4-methyl-1H-pyrazole-5-carboxylate |
| InChIKey | IUCWUXRZUIMIRL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NN1)C#N)C |
Computed by PubChem (NCBI)