Products 82945-27-5
CAS 82945-27-5 is the registry number for 1,1,1-Trifluoro-3-nitro-2-phenylpropan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1-trifluoro-3-nitro-2-phenylpropan-2-ol (CAS 82945-27-5) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 1,1,1-trifluoro-3-nitro-2-phenylpropan-2-ol. InChIKey: CEYAQLFOMNYIRE-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-nitro-2-phenylpropan-2-ol |
| InChIKey | CEYAQLFOMNYIRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C[N+](=O)[O-])(C(F)(F)F)O |
Computed by PubChem (NCBI)