Products 82977-10-4
CAS 82977-10-4 is the registry number for L-Ascorbic acid-d2, 99.90%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 25 mg, 10 mg.
(2R)-2-[(1S)-2,2-dideuterio-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one (CAS 82977-10-4) is a chemical compound with the molecular formula C6H8O6 and a molecular weight of 178.14 g/mol. IUPAC name: (2R)-2-[(1S)-2,2-dideuterio-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one. InChIKey: CIWBSHSKHKDKBQ-PPVDTKEISA-N.
| Molecular formula | C6H8O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | (2R)-2-[(1S)-2,2-dideuterio-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| InChIKey | CIWBSHSKHKDKBQ-PPVDTKEISA-N |
| SMILES | [2H]C([2H])([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
L-Ascorbic acid-d2, orb3138357