CAS 83-01-2 appears in our catalog under these names: Temozolomide Impurity 7, Diphenylcarbamic Chloride, N,N-Diphenylcarbamyl Chloride, Diphenylcarbamyl chloride, 98% , Diphenylcarbamoyl Chloride, >98.0%(GC)(T). Offered by: Chemat Brand, Mikromol, TRC, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: on request, 25mg, 10g, 25g, 50g, 100g, 5g, 500g.
N,N-diphenylcarbamoyl chloride (CAS 83-01-2) is a chemical compound with the molecular formula C13H10ClNO and a molecular weight of 231.68 g/mol. IUPAC name: N,N-diphenylcarbamoyl chloride. InChIKey: XNBKKRFABABBPM-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | N,N-diphenylcarbamoyl chloride |
| InChIKey | XNBKKRFABABBPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)