CAS 83-87-4 appears in our catalog under these names: Peracetylated D–glucose, 1,2,3,4,6-Penta-O-acetyl-D-glucopyranose, (3R,4S,5R,6R)-6-(Acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 95%, 95%, D-Glucose pentaacetate, 99.94%, (3R,4S,5R,6R)-6-(Acetoxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 95%. Offered by: GLPBio, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 500g, 50g, 250g, 1000g, 250mg, 25g, 1 g.
[(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate (CAS 83-87-4) is a chemical compound with the molecular formula C16H22O11 and a molecular weight of 390.34 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate. InChIKey: LPTITAGPBXDDGR-IWQYDBTJSA-N.
| Molecular formula | C16H22O11 |
|---|---|
| Molecular weight | 390.34 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | LPTITAGPBXDDGR-IWQYDBTJSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)