CAS 83004-08-4 is the registry number for 2-(Bromomethyl)-6-nitropyridine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 25g.
2-(bromomethyl)-6-nitropyridine (CAS 83004-08-4) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 2-(bromomethyl)-6-nitropyridine. InChIKey: HCYOIAGXVSXBIB-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2-(bromomethyl)-6-nitropyridine |
| InChIKey | HCYOIAGXVSXBIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)