Products 83016-16-4
CAS 83016-16-4 is the registry number for Cannithrene 2. Offered by: TRC. Available pack sizes: 25mg.
2,6-dimethoxy-9,10-dihydrophenanthrene-4,5-diol (CAS 83016-16-4) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: 2,6-dimethoxy-9,10-dihydrophenanthrene-4,5-diol. InChIKey: JOPGVVOTXYNMIS-UHFFFAOYSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 2,6-dimethoxy-9,10-dihydrophenanthrene-4,5-diol |
| InChIKey | JOPGVVOTXYNMIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCC3=C2C(=CC(=C3)OC)O)C=C1)O |
Computed by PubChem (NCBI)
Synonyms:
Cannithrene 2