CAS 83071-67-4 appears in our catalog under these names: 4-Acetoxy-3-methoxycinnamaldehyde, 95%, 4-ACETOXY-3-METHOXYCINNAMALDEHYDE,95%,PR. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g.
[2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate (CAS 83071-67-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: [2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate. InChIKey: VEKAJHBFBMWJKI-ARJAWSKDSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | [2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate |
| InChIKey | VEKAJHBFBMWJKI-ARJAWSKDSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)/C=C\C=O)OC |
Computed by PubChem (NCBI)