Products 831222-68-5

CAS 831222-68-5 is the registry number for Ethyl 4-hydroxy-1-benzothiophene-6-carboxylate. Offered by: Biosynth. Available pack sizes: 10g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 4-hydroxy-1-benzothiophene-6-carboxylate (CAS 831222-68-5) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: ethyl 4-hydroxy-1-benzothiophene-6-carboxylate. InChIKey: IRKXYMTWJQZIPG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3S
Molecular weight222.26 g/mol
IUPAC nameethyl 4-hydroxy-1-benzothiophene-6-carboxylate
InChIKeyIRKXYMTWJQZIPG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C2C=CSC2=C1)O

Computed by PubChem (NCBI)