CAS 832739-18-1 is the registry number for 3-((4-Chloro-2-methylphenoxy)methyl)benzohydrazide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-[(4-chloro-2-methylphenoxy)methyl]benzohydrazide (CAS 832739-18-1) is a chemical compound with the molecular formula C15H15ClN2O2 and a molecular weight of 290.74 g/mol. IUPAC name: 3-[(4-chloro-2-methylphenoxy)methyl]benzohydrazide. InChIKey: SZWFWGCQNBTZKE-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2O2 |
|---|---|
| Molecular weight | 290.74 g/mol |
| IUPAC name | 3-[(4-chloro-2-methylphenoxy)methyl]benzohydrazide |
| InChIKey | SZWFWGCQNBTZKE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OCC2=CC(=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)