Products 832740-95-1

CAS 832740-95-1 is the registry number for 3-((2,3-Dichlorophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-[(2,3-dichlorophenoxy)methyl]benzoic acid (CAS 832740-95-1) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 3-[(2,3-dichlorophenoxy)methyl]benzoic acid. InChIKey: BQPYAKYXWINEQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10Cl2O3
Molecular weight297.1 g/mol
IUPAC name3-[(2,3-dichlorophenoxy)methyl]benzoic acid
InChIKeyBQPYAKYXWINEQQ-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)COC2=C(C(=CC=C2)Cl)Cl

Computed by PubChem (NCBI)