CAS 832740-95-1 is the registry number for 3-((2,3-Dichlorophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[(2,3-dichlorophenoxy)methyl]benzoic acid (CAS 832740-95-1) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: 3-[(2,3-dichlorophenoxy)methyl]benzoic acid. InChIKey: BQPYAKYXWINEQQ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | 3-[(2,3-dichlorophenoxy)methyl]benzoic acid |
| InChIKey | BQPYAKYXWINEQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)