Products 832741-26-1

CAS 832741-26-1 is the registry number for 4-Methoxy-3-(morpholin-4-ylmethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-methoxy-3-(morpholin-4-ylmethyl)benzoic acid (CAS 832741-26-1) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 4-methoxy-3-(morpholin-4-ylmethyl)benzoic acid. InChIKey: XQGGOCJADNCVHW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO4
Molecular weight251.28 g/mol
IUPAC name4-methoxy-3-(morpholin-4-ylmethyl)benzoic acid
InChIKeyXQGGOCJADNCVHW-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)CN2CCOCC2

Computed by PubChem (NCBI)