CAS 83287-02-9 is the registry number for Menisporphine. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
5,10,11-trimethoxy-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one (CAS 83287-02-9) is a chemical compound with the molecular formula C19H15NO4 and a molecular weight of 321.3 g/mol. IUPAC name: 5,10,11-trimethoxy-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one. InChIKey: LHRMNRPHVHDOJH-UHFFFAOYSA-N.
| Molecular formula | C19H15NO4 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 5,10,11-trimethoxy-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaen-8-one |
| InChIKey | LHRMNRPHVHDOJH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=NC=CC4=CC(=C(C(=C43)C2=O)OC)OC |
Computed by PubChem (NCBI)