CAS 83303-98-4 appears in our catalog under these names: Mirabegron Impurity 30, Mirabegron Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide (CAS 83303-98-4) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide. InChIKey: APONERWNAIBFPP-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide |
| InChIKey | APONERWNAIBFPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NCCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)