CAS 833472-82-5 appears in our catalog under these names: (3–(3–Methoxy–3–oxopropyl)phenyl)boronic acid, 3-(2-Methoxycarbonylethyl)benzeneboronic acid, 97% , (3-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 97%, 97%, (3-(3-Methoxy-3-oxopropyl)phenyl)boronic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
[3-(3-methoxy-3-oxopropyl)phenyl]boronic acid (CAS 833472-82-5) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: [3-(3-methoxy-3-oxopropyl)phenyl]boronic acid. InChIKey: IPXZIWCEVNDHFD-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | [3-(3-methoxy-3-oxopropyl)phenyl]boronic acid |
| InChIKey | IPXZIWCEVNDHFD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CCC(=O)OC)(O)O |
Computed by PubChem (NCBI)