Products 833485-13-5
CAS 833485-13-5 is the registry number for (3-(Pyridin-2-yl)phenyl)boronic acid 98+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(3-pyridin-2-ylphenyl)boronic acid (CAS 833485-13-5) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (3-pyridin-2-ylphenyl)boronic acid. InChIKey: BGZNRSHKBRRARR-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (3-pyridin-2-ylphenyl)boronic acid |
| InChIKey | BGZNRSHKBRRARR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=CC=N2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-(Pyridin-2-yl)phenyl)boronic acid, 3-(pyridin-2-yl)phenylboronic acid, [3-(Pyridin-2-yl)phenyl]boronic acid, B-[3-(2-Pyridinyl)phenyl]boronic acid, (3-pyridin-2-ylphenyl)boronic acid, 3-(Pyridine-2-yl)phenylboronic acid, starbld0017160, Boronic acid, [3-(2-pyridinyl)phenyl]-, 3-(2-pyridyl)phenylboronic acid, BGZNRSHKBRRARR-UHFFFAOYSA-N