Products 83463-12-1
CAS 83463-12-1 is the registry number for 4-Phenylpyridine-2,6-dicarboxylic acid, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
4-phenylpyridine-2,6-dicarboxylic acid (CAS 83463-12-1) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-phenylpyridine-2,6-dicarboxylic acid. InChIKey: VHENPTPXTMAFOQ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-phenylpyridine-2,6-dicarboxylic acid |
| InChIKey | VHENPTPXTMAFOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)