CAS 83516-65-8 is the registry number for 6-Styryl-3-pyridazinol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(E)-2-phenylethenyl]-1H-pyridazin-6-one (CAS 83516-65-8) is a chemical compound with the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. IUPAC name: 3-[(E)-2-phenylethenyl]-1H-pyridazin-6-one. InChIKey: KQZVCMCKJNRGRG-VOTSOKGWSA-N.
| Molecular formula | C12H10N2O |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 3-[(E)-2-phenylethenyl]-1H-pyridazin-6-one |
| InChIKey | KQZVCMCKJNRGRG-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=NNC(=O)C=C2 |
Computed by PubChem (NCBI)