CAS 83552-28-7 is the registry number for Methyl (2S,4R)-4-(methylsulfanyl)pyrrolidine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2S,4R)-4-methylsulfanylpyrrolidine-2-carboxylate;hydrochloride (CAS 83552-28-7) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: methyl (2S,4R)-4-methylsulfanylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: VWAIFUOQWVBJJX-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2S |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | methyl (2S,4R)-4-methylsulfanylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | VWAIFUOQWVBJJX-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1C[C@H](CN1)SC.Cl |
Computed by PubChem (NCBI)