Products 835638-57-8
CAS 835638-57-8 is the registry number for Levocarnitine Impurity A. Offered by: Chemat Brand. Available pack sizes: on request.
[(Z)-3-carboxyprop-2-enyl]-trimethylazanium chloride (CAS 835638-57-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: [(Z)-3-carboxyprop-2-enyl]-trimethylazanium chloride. InChIKey: PUKNFWRLBQXPFL-MKWAYWHRSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | [(Z)-3-carboxyprop-2-enyl]-trimethylazanium chloride |
| InChIKey | PUKNFWRLBQXPFL-MKWAYWHRSA-N |
| SMILES | C[N+](C)(C)C/C=C\C(=O)O.[Cl-] |
Computed by PubChem (NCBI)