CAS 83777-68-8 appears in our catalog under these names: R-(+)-Norketamine hydrochloride, >95% (HPLC), (R)–Norketamine hydrochloride, (R)-Norketamine hydrochloride, Ketamine hydrochloride Impurity 1. Offered by: TRC, GLPBio, Biosynth, Chemat Brand. Available pack sizes: 10mg, 1mg, 5mg, on request.
(2R)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride (CAS 83777-68-8) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (2R)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride. InChIKey: CLPOJGPBUGCUKT-UTONKHPSSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride |
| InChIKey | CLPOJGPBUGCUKT-UTONKHPSSA-N |
| SMILES | C1CC[C@](C(=O)C1)(C2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)