CAS 83777-70-2 appears in our catalog under these names: Ketamine hydrochloride Impurity 2, S-(-)-Norketamine Hydrochloride, >95% (HPLC), S-Norketamine Hydrochloride (1.0mg/ml in Methanol), (S)–Norketamine hydrochloride, (S)-Norketamine hydrochloride. Offered by: Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 1x1ml, 5mg.
(2S)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride (CAS 83777-70-2) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: (2S)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride. InChIKey: CLPOJGPBUGCUKT-YDALLXLXSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-chlorophenyl)cyclohexan-1-one;hydrochloride |
| InChIKey | CLPOJGPBUGCUKT-YDALLXLXSA-N |
| SMILES | C1CC[C@@](C(=O)C1)(C2=CC=CC=C2Cl)N.Cl |
Computed by PubChem (NCBI)