Products 83817-50-9

CAS 83817-50-9 is the registry number for Cloxacillin Sodium Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 83817-50-9) is a chemical compound with the molecular formula C13H12ClNO3 and a molecular weight of 265.69 g/mol. IUPAC name: ethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: QFOIBTBRETTXIK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO3
Molecular weight265.69 g/mol
IUPAC nameethyl 3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate
InChIKeyQFOIBTBRETTXIK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(ON=C1C2=CC=CC=C2Cl)C

Computed by PubChem (NCBI)