CAS 84023-58-5 appears in our catalog under these names: (S)-2-(((S)-1-Carboxyethyl)amino)-4-phenylbutanoic acid, 98%, Enalaprilat EP Impurity A (S,S-Isomer), Imidapril Impurity 2, (AlphaS)-Alpha-(((1S)-1-Carboxyethyl)amino)benzenebutanoic Acid, >95% (HPLC), (aS)-a-(((1S)-1-Carboxyethyl)amino)benzenebutanoic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(2S)-2-[[(1S)-1-carboxyethyl]amino]-4-phenylbutanoic acid (CAS 84023-58-5) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: (2S)-2-[[(1S)-1-carboxyethyl]amino]-4-phenylbutanoic acid. InChIKey: ULHDMLUUUQSHMK-ONGXEEELSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1-carboxyethyl]amino]-4-phenylbutanoic acid |
| InChIKey | ULHDMLUUUQSHMK-ONGXEEELSA-N |
| SMILES | C[C@@H](C(=O)O)N[C@@H](CCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)