CAS 842112-66-7 appears in our catalog under these names: 6-Formyl-2-methyl-4H-thieno(3,2-b)pyrrole-5-carboxylic acid, 95%, 6-Formyl-2-methyl-4H-thieno(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 5mg, 2mg, 10mg, 25mg, 50mg.
6-formyl-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CAS 842112-66-7) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 6-formyl-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid. InChIKey: UIXMSKWGNJIRTA-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 6-formyl-2-methyl-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | UIXMSKWGNJIRTA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C(=C(N2)C(=O)O)C=O |
Computed by PubChem (NCBI)