Products 842135-03-9
CAS 842135-03-9 is the registry number for 5-bromo-N-methoxy-N,2-dimethylbenzamide, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
5-bromo-N-methoxy-N,2-dimethylbenzamide (CAS 842135-03-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 5-bromo-N-methoxy-N,2-dimethylbenzamide. InChIKey: ZJAGXJWJPPDLOV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 5-bromo-N-methoxy-N,2-dimethylbenzamide |
| InChIKey | ZJAGXJWJPPDLOV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C(=O)N(C)OC |
Computed by PubChem (NCBI)