Products 84257-50-1
CAS 84257-50-1 is the registry number for N-(4-Formyl-3-methylphenyl)acetamide, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
N-(4-formyl-3-methylphenyl)acetamide (CAS 84257-50-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(4-formyl-3-methylphenyl)acetamide. InChIKey: OQWBSIMVDHAYEQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(4-formyl-3-methylphenyl)acetamide |
| InChIKey | OQWBSIMVDHAYEQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)C)C=O |
Computed by PubChem (NCBI)