CAS 84264-43-7 appears in our catalog under these names: 2,4-Dimethylquinolin-6-amine, 95%, 2,4-Dimethylquinolin-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dimethylquinolin-6-amine (CAS 84264-43-7) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 2,4-dimethylquinolin-6-amine. InChIKey: FIXPRKPDAIMNAY-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 2,4-dimethylquinolin-6-amine |
| InChIKey | FIXPRKPDAIMNAY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C(C=C2)N)C |
Computed by PubChem (NCBI)