CAS 843608-45-7 appears in our catalog under these names: 1-(3-Bromophenyl)-2,2,2-trifluoroethanamine, 1-(3-Bromophenyl)-2,2,2-trifluoroethanamine 95%, 1-(3-BROMOPHENYL)-2,2,2-TRIFLUOROETHANAMINE, 95%, 95%, 1-(3-BROMOPHENYL)-2,2,2-TRIFLUOROETHANAMINE, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 500mg, 5g.
1-(3-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-45-7) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: WBOABZOPYZNWCX-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | WBOABZOPYZNWCX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)(F)F)N |
Computed by PubChem (NCBI)