CAS 84403-70-3 appears in our catalog under these names: 4–((3–Chlorobenzyl)oxy)benzoic acid, 4-(3-Chloro-benzyloxy)benzoic acid, 4-[(3-Chlorobenzyl)oxy]benzoic acid, 97%, 4-[(3-chlorobenzyl)oxy]benzoic acid, 98%, 4-((3-chlorobenzyl)oxy)benzoic acid, 98%, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 500mg, 1000mg, 2000mg, 5000mg, 1g, 5g, 100mg.
4-[(3-chlorophenyl)methoxy]benzoic acid (CAS 84403-70-3) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 4-[(3-chlorophenyl)methoxy]benzoic acid. InChIKey: QMXPJNHJNFUZAT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 4-[(3-chlorophenyl)methoxy]benzoic acid |
| InChIKey | QMXPJNHJNFUZAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)COC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)