Products 84413-76-3
CAS 84413-76-3 is the registry number for Deoxyradicinin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-methyl-7-[(E)-prop-1-enyl]-2,3-dihydropyrano[3,2-c]pyran-4,5-dione (CAS 84413-76-3) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (2S)-2-methyl-7-[(E)-prop-1-enyl]-2,3-dihydropyrano[3,2-c]pyran-4,5-dione. InChIKey: SHGIAYIFKLLQOL-SDLBARTOSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (2S)-2-methyl-7-[(E)-prop-1-enyl]-2,3-dihydropyrano[3,2-c]pyran-4,5-dione |
| InChIKey | SHGIAYIFKLLQOL-SDLBARTOSA-N |
| SMILES | C/C=C/C1=CC2=C(C(=O)C[C@@H](O2)C)C(=O)O1 |
Computed by PubChem (NCBI)