Products 844648-10-8
CAS 844648-10-8 is the registry number for 8-Fluoro-2,3,4,5-tetrahydro-1,4-benzoxazepin-5-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CAS 844648-10-8) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one. InChIKey: UTQCOPZWZFHBAJ-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 8-fluoro-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| InChIKey | UTQCOPZWZFHBAJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)