CAS 844658-92-0 appears in our catalog under these names: Etomidate impurity 7, Etomidate Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1R)-1-phenylethyl]imidazole (CAS 844658-92-0) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 1-[(1R)-1-phenylethyl]imidazole. InChIKey: ZXIUPWHIKAQKOG-SNVBAGLBSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 1-[(1R)-1-phenylethyl]imidazole |
| InChIKey | ZXIUPWHIKAQKOG-SNVBAGLBSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2C=CN=C2 |
Computed by PubChem (NCBI)