Products 845619-77-4
CAS 845619-77-4 is the registry number for 1-Pivaloyl-5-methoxyindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-(5-methoxyindol-1-yl)-2,2-dimethylpropan-1-one (CAS 845619-77-4) is a chemical compound with the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. IUPAC name: 1-(5-methoxyindol-1-yl)-2,2-dimethylpropan-1-one. InChIKey: UOZSZNMYJWQUKO-UHFFFAOYSA-N.
| Molecular formula | C14H17NO2 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 1-(5-methoxyindol-1-yl)-2,2-dimethylpropan-1-one |
| InChIKey | UOZSZNMYJWQUKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C=CC2=C1C=CC(=C2)OC |
Computed by PubChem (NCBI)