CAS 845729-50-2 is the registry number for 2-(2-Chloroethoxy)-N-(2-nitrophenyl)-acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
2-(2-chloroethoxy)-N-(2-nitrophenyl)acetamide (CAS 845729-50-2) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: 2-(2-chloroethoxy)-N-(2-nitrophenyl)acetamide. InChIKey: GRVJIUVJMGNMBY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | 2-(2-chloroethoxy)-N-(2-nitrophenyl)acetamide |
| InChIKey | GRVJIUVJMGNMBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)COCCCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)