Products 845823-13-4
CAS 845823-13-4 appears in our catalog under these names: 4′–Chloro–2′–methyl–2,2,2–trifluoroacetophenone, 4'-Chloro-2'-Methyl-2,2,2-Trifluoroacetophenone, 4'-Chloro-2'-methyl-2,2,2-trifluoroacetophenone, 98%, 1-(4-Chloro-2-methylphenyl)-2,2,2-trifluoroethanone 98%, 1-(4-Chloro-2-methylphenyl)-2,2,2-trifluoroethanone, 98%, 98%. Offered by: GLPBio, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 0,5g, 0,25g, 100mg, 250mg, 10g.
1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone (CAS 845823-13-4) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone. InChIKey: SJBSFYVEKYGCAS-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | SJBSFYVEKYGCAS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)