CAS 847577-89-3 is the registry number for 6-(Benzyloxy)quinolin-4-ol, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-phenylmethoxy-1H-quinolin-4-one (CAS 847577-89-3) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 6-phenylmethoxy-1H-quinolin-4-one. InChIKey: WEMMRLBJXSUNTG-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 6-phenylmethoxy-1H-quinolin-4-one |
| InChIKey | WEMMRLBJXSUNTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC=CC3=O |
Computed by PubChem (NCBI)